Identiteet
Propofol dimer impurity
Pole loetletud · C24H32O4
01Identiteet
| Lazychem ID | LC-37667 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 74788585 |
| Molecular formula | C24H32O4 |
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2,4,9,11-tetra(propan-2-yl)-13,14-dioxadispiro[5.0.57.26]tetradeca-1,4,8,11-tetraene-3,10-dione |
| InChIKey | BJMZWGFLSUKBJS-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 74788585

The parsed structure contains 3 rings, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)C1=CC2(C=C(C1=O)C(C)C)C3(C=C(C(=O)C(=C3)C(C)C)C(C)C)OO2 |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
05Allikad
- S01PubChem CID 74788585
Structure and machine-readable chemical identifiers.
