
Identiteet
Paricalcitol Impurity 3
Pole loetletud · C27H44O3
01Identiteet
| Lazychem ID | LC-35854 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 124389594 |
| Molecular formula | C27H44O3 |
| Molecular weight | 416.6 g/mol |
| IUPAC name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(Z,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
| InChIKey | BPKAHTKRCLCHEA-DCUJIKHJSA-N |
02Struktuur ja stereokeemia

The parsed structure contains 3 rings, includes aliphatic carbon, has 7 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 7 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[C@H](/C=C\[C@H](C)C(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C3C[C@H](C[C@@H](C3)O)O)C |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 7 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
5 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.





Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 124389594
Structure and machine-readable chemical identifiers.
