Identiteet
Benzthiazide
CAS 91-33-8 · C15H14ClN3O4S3
01Identiteet
| Lazychem ID | LC-100688 |
|---|---|
| CAS RN | 91-33-8 |
| PubChem CID | 2343 |
| Molecular formula | C15H14ClN3O4S3 |
| Molecular weight | 431.9 g/mol |
| IUPAC name | 3-(benzylsulfanylmethyl)-6-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | NDTSRXAMMQDVSW-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 2343

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)CSCC2=NS(=O)(=O)C3=CC(=C(C=C3N2)Cl)S(=O)(=O)N |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
- benzthiazide
- 91-33-8
- Benzothiazide
- Aquatag
- Fovane
- Exna
- Dihydrex
- Lemazide
- Urese
- Freeuril
- Diucen
- Edemex
05Allikad
- S01PubChem CID 2343
Structure and machine-readable chemical identifiers.
