Identiteet
Acyclovir EP Impurity R
Pole loetletud · C17H22N10O6
01Identiteet
| Lazychem ID | LC-04978 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 138393908 |
| Molecular formula | C17H22N10O6 |
| Molecular weight | 462.43 |
| IUPAC name | 9,9'-(2,5,7,10-tetraoxaundecane-1,11-diyl)bis(2-amino-1,9-dihydro-6H-purin-6-one) |
| InChIKey | JJFFDXJGVPFUQM-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 138393908

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | Nc4nc1c(ncn1COCCOCOCCOCn3cnc2c(=O)[nH]c(N)nc23)c(=O)[nH]4 |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Acyclovir
Lisandid ja seotud ühendidNimed ja seosed
05Allikad
- S01PubChem CID 138393908
Structure and machine-readable chemical identifiers.
