Ταυτότητα
N-Nitroso Palbociclib 2
Δεν αναφέρεται · C24H28N8O3
01Ταυτότητα
| Lazychem ID | LC-22258 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 176475624 |
| Molecular formula | C24H28N8O3 |
| Molecular weight | 476.53 g/mol |
| IUPAC name | N-(6-acetyl-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl)-N-(5-(piperazin-1-yl)pyridin-2-yl)nitrous amide |
| InChIKey | RXUUCZXKXQGYSN-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 176475624

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 1 |
| Tertiary amines | 2 |
| SMILES | O=NN(C1=NC=C(C(C)=C(C(C)=O)C(N2C3CCCC3)=O)C2=N1)C4=NC=C(N5CCNCC5)C=C4 |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Palbociclib
Προσμίξεις και συγγενείς ενώσειςΟνόματα και σχέσεις
05Πηγές
- S01PubChem CID 176475624
Structure and machine-readable chemical identifiers.
