Ταυτότητα
3-Methoxy-2-nitrobenzamide
Δεν αναφέρεται · C8H8N2O4
01Ταυτότητα
| Lazychem ID | LC-98957 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 1274493 |
| Molecular formula | C8H8N2O4 |
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-methoxy-2-nitrobenzamide |
| InChIKey | MZGJDLQJIXSZRB-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 1274493
The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC=CC(=C1[N+](=O)[O-])C(=O)N |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 1274493
Structure and machine-readable chemical identifiers.