Ταυτότητα
5-Nitro-2-indanone
Δεν αναφέρεται · C9H7NO3
01Ταυτότητα
| Lazychem ID | LC-98592 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 1502066 |
| Molecular formula | C9H7NO3 |
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-nitro-1,3-dihydroinden-2-one |
| InChIKey | VSEBFWRYDORZJI-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 1502066

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1C(=O)CC2=C1C=CC(=C2)[N+](=O)[O-] |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 1502066
Structure and machine-readable chemical identifiers.
