Ταυτότητα
Nvp 231
Δεν αναφέρεται · C25H25N3O2S
01Ταυτότητα
| Lazychem ID | LC-87718 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 4096211 |
| Molecular formula | C25H25N3O2S |
| Molecular weight | 431.6 g/mol |
| IUPAC name | N-(2-benzamido-1,3-benzothiazol-6-yl)adamantane-1-carboxamide |
| InChIKey | MVSSJPGNLQPWSW-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 4096211
The parsed structure contains 7 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 7 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC5=C(C=C4)N=C(S5)NC(=O)C6=CC=CC=C6 |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 4096211
Structure and machine-readable chemical identifiers.