Ταυτότητα
5-CFDA N-succinimidyl ester
Δεν αναφέρεται · C29H19NO11
01Ταυτότητα
| Lazychem ID | LC-87696 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 4104744 |
| Molecular formula | C29H19NO11 |
| Molecular weight | 557.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | SRSXVRUMXPCNAJ-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 4104744

The parsed structure contains 6 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 6 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)OC(=O)C |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 4104744
Structure and machine-readable chemical identifiers.
