Ταυτότητα
Cerc 006
Δεν αναφέρεται · C21H22N6O3
01Ταυτότητα
| Lazychem ID | LC-55350 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 135398516 |
| Molecular formula | C21H22N6O3 |
| Molecular weight | 406.4 g/mol |
| IUPAC name | 4-[4-amino-5-(7-methoxy-1H-indol-2-yl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexane-1-carboxylic acid |
| InChIKey | JROFGZPOBKIAEW-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 135398516
The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC=CC2=C1NC(=C2)C3=C4C(=NC=NN4C(=N3)C5CCC(CC5)C(=O)O)N |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 135398516
Structure and machine-readable chemical identifiers.