Ταυτότητα
Nalidixic Acid
Δεν αναφέρεται · C12H12N2O3
01Ταυτότητα
| Lazychem ID | LC-54554 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 4421 |
| Molecular formula | C12H12N2O3 |
| Molecular weight | 232.23 g/mol |
| IUPAC name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 4421
The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 4421
Structure and machine-readable chemical identifiers.