Ταυτότητα
Riluzole
Δεν αναφέρεται · C8H5F3N2OS
01Ταυτότητα
| Lazychem ID | LC-54521 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 5070 |
| Molecular formula | C8H5F3N2OS |
| Molecular weight | 234.20 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | FTALBRSUTCGOEG-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 5070

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)SC(=N2)N |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 5070
Structure and machine-readable chemical identifiers.
