Ταυτότητα
6-Nitroisatin
Δεν αναφέρεται · C8H4N2O4
01Ταυτότητα
| Lazychem ID | LC-110905 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 248832 |
| Molecular formula | C8H4N2O4 |
| Molecular weight | 192.13 g/mol |
| IUPAC name | 6-nitro-1H-indole-2,3-dione |
| InChIKey | FQMOARKYYKXWRB-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 248832
The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=O)C2=O |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 248832
Structure and machine-readable chemical identifiers.