Ταυτότητα
1-(4-Bromophenyl)adamantane
Δεν αναφέρεται · C16H19Br
01Ταυτότητα
| Lazychem ID | LC-104159 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 625922 |
| Molecular formula | C16H19Br |
| Molecular weight | 291.23 g/mol |
| IUPAC name | 1-(4-bromophenyl)adamantane |
| InChIKey | KCZDTZZRNNRKQE-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 625922

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)Br |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
05Πηγές
- S01PubChem CID 625922
Structure and machine-readable chemical identifiers.
