Ταυτότητα
Phthalic Acid
Δεν αναφέρεται · C8H6O4
01Ταυτότητα
| Lazychem ID | LC-100589 |
|---|---|
| CAS RN | Δεν αναφέρεται |
| PubChem CID | 54478426 |
| Molecular formula | C8H6O4 |
| Molecular weight | 168.12 g/mol |
| IUPAC name | phthalic acid |
| InChIKey | XNGIFLGASWRNHJ-WGGUOBTBSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 54478426

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[14C](=O)O |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
- CID 54478426
05Πηγές
- S01PubChem CID 54478426
Structure and machine-readable chemical identifiers.
