Ταυτότητα
2-Nitro-p-xylene
CAS 89-58-7 · C8H9NO2
01Ταυτότητα
| Lazychem ID | LC-02072 |
|---|---|
| CAS RN | 89-58-7 |
| PubChem CID | 6974 |
| Molecular formula | C8H9NO2 |
| Molecular weight | 151.16 g/mol |
| IUPAC name | 1,4-dimethyl-2-nitrobenzene |
| InChIKey | BSFHJMGROOFSRA-UHFFFAOYSA-N |
02Δομή και στερεοχημεία
2D structurePubChem CID 6974

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=[N+]([O-])C1=CC(C)=CC=C1C |
|---|---|
| InChI | Δεν αναφέρεται |
03Κατάσταση στην Ινδία
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ονόματα και σχέσεις
API και μητρικό φάρμακο
Δεν αναφέρεται
Ονόματα και σχέσεις
- 2,5-Dimethylnitrobenzene
- 2-Nitro-4-xylene
- 1-Nitro-2,5-dimethylbenzene
05Πηγές
- S01PubChem CID 6974
Structure and machine-readable chemical identifiers.
