Identität
Dinitroso Palbociclib
Nicht angegeben · C24H27N9O4
01Identität
| Lazychem ID | LC-13086 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 176475625 |
| Molecular formula | C24H27N9O4 |
| Molecular weight | 505.05 g/mol |
| IUPAC name | N-(6-acetyl-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl)-N-(5-(4-nitrosopiperazin-1-yl)pyridin-2-yl)nitrous amide |
| InChIKey | ANJMCXVYHHJPMY-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 176475625

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 3 |
| SMILES | O=NN(C1=NC=C(C(C)=C(C(C)=O)C(N2C3CCCC3)=O)C2=N1)C4=NC=C(N5CCN(N=O)CC5)C=C4 |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Palbociclib
Verunreinigungen und verwandte VerbindungenNamen und Beziehungen
- Palbociclib Nitroso Impurity 2
05Quellen
- S01PubChem CID 176475625
Structure and machine-readable chemical identifiers.
