Identität
Dithranol EP Impurity D (Free Base)
CAS 1715-81-7 · C14H10O2
01Identität
| Lazychem ID | LC-13210 |
|---|---|
| CAS RN | 1715-81-7 |
| PubChem CID | 150937 |
| Molecular formula | C14H10O2 |
| Molecular weight | 210.2 g/mol |
| IUPAC name | 1-Hydroxyanthracen-9(10H)-one |
| InChIKey | AXHRXVXCOMMNLG-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 150937

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C1C2=C(C=CC=C2)CC3=CC=CC(O)=C13 |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Dithranol
Verunreinigungen und verwandte VerbindungenNamen und Beziehungen
- 1-Hydroxyanthrone
- 1-Hydroxy-9-anthrone
- 1-Hydroxy-10H-anthracen-9-one
- 9-Anthronol
- 9(10H)-Anthracenone, 1-hydroxy
05Quellen
- S01PubChem CID 150937
Structure and machine-readable chemical identifiers.
