Identität
2-Pyrazolylbenzoic acid
Nicht angegeben · C10H8N2O2
01Identität
| Lazychem ID | LC-86537 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 4738383 |
| Molecular formula | C10H8N2O2 |
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-pyrazol-1-ylbenzoic acid |
| InChIKey | MHACZVWKWUMHRR-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 4738383

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N2C=CC=N2 |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 4738383
Structure and machine-readable chemical identifiers.
