Identität
Morantel citrate
Nicht angegeben · C18H24N2O7S
01Identität
| Lazychem ID | LC-84513 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 5702276 |
| Molecular formula | C18H24N2O7S |
| Molecular weight | 412.5 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine |
| InChIKey | OLOCXIJVDIVAHH-FXRZFVDSSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 5702276

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1=C(SC=C1)/C=C/C2=NCCCN2C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 5702276
Structure and machine-readable chemical identifiers.
