Identität
SU 5614
Nicht angegeben · C15H13ClN2O
01Identität
| Lazychem ID | LC-83797 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 6536806 |
| Molecular formula | C15H13ClN2O |
| Molecular weight | 272.73 g/mol |
| IUPAC name | (3Z)-5-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| InChIKey | XLBQNZICMYZIQT-GHXNOFRVSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 6536806

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC(=C(N1)/C=C\2/C3=C(C=CC(=C3)Cl)NC2=O)C |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 6536806
Structure and machine-readable chemical identifiers.
