Identität
Penoxsulam
Nicht angegeben · C16H14F5N5O5S
01Identität
| Lazychem ID | LC-76487 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 11784975 |
| Molecular formula | C16H14F5N5O5S |
| Molecular weight | 483.4 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)-N-(5,8-dimethoxy-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-6-(trifluoromethyl)benzenesulfonamide |
| InChIKey | SYJGKVOENHZYMQ-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 11784975

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CN=C(N2C1=NC(=N2)NS(=O)(=O)C3=C(C=CC=C3OCC(F)F)C(F)(F)F)OC |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 11784975
Structure and machine-readable chemical identifiers.
