Identität
STO-609 acetate
Nicht angegeben · C21H14N2O5
01Identität
| Lazychem ID | LC-69919 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 16760660 |
| Molecular formula | C21H14N2O5 |
| Molecular weight | 374.3 g/mol |
| IUPAC name | acetic acid;11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaene-17-carboxylic acid |
| InChIKey | WNRSTFUVBWNELX-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 16760660

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)O.C1=CC=C2C(=C1)N=C3N2C(=O)C4=CC=CC5=C(C=CC3=C54)C(=O)O |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 16760660
Structure and machine-readable chemical identifiers.
