Identität
Mk-8245
Nicht angegeben · C17H16BrFN6O4
01Identität
| Lazychem ID | LC-63498 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 24988881 |
| Molecular formula | C17H16BrFN6O4 |
| Molecular weight | 467.2 g/mol |
| IUPAC name | 2-[5-[3-[4-(2-bromo-5-fluorophenoxy)piperidin-1-yl]-1,2-oxazol-5-yl]tetrazol-2-yl]acetic acid |
| InChIKey | UJEAABFSXKCSGI-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 24988881

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | C1CN(CCC1OC2=C(C=CC(=C2)F)Br)C3=NOC(=C3)C4=NN(N=N4)CC(=O)O |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 24988881
Structure and machine-readable chemical identifiers.
