Identität
PF-8380
Nicht angegeben · C22H21Cl2N3O5
01Identität
| Lazychem ID | LC-63251 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 25265312 |
| Molecular formula | C22H21Cl2N3O5 |
| Molecular weight | 478.3 g/mol |
| IUPAC name | (3,5-dichlorophenyl)methyl 4-[3-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propyl]piperazine-1-carboxylate |
| InChIKey | JMSUDQYHPSNBSN-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 25265312

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | C1CN(CCN1CCC(=O)C2=CC3=C(C=C2)NC(=O)O3)C(=O)OCC4=CC(=CC(=C4)Cl)Cl |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 25265312
Structure and machine-readable chemical identifiers.
