Identität
CX-6258
Nicht angegeben · C26H24ClN3O3
01Identität
| Lazychem ID | LC-61668 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 44545852 |
| Molecular formula | C26H24ClN3O3 |
| Molecular weight | 461.9 g/mol |
| IUPAC name | (3E)-5-chloro-3-[[5-[3-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one |
| InChIKey | KGBPLKOPSFDBOX-CJLVFECKSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 44545852

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN1CCCN(CC1)C(=O)C2=CC=CC(=C2)C3=CC=C(O3)/C=C/4\C5=C(C=CC(=C5)Cl)NC4=O |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 44545852
Structure and machine-readable chemical identifiers.
