Identität
Bropirimine
Nicht angegeben · C10H8BrN3O
01Identität
| Lazychem ID | LC-55200 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 135413497 |
| Molecular formula | C10H8BrN3O |
| Molecular weight | 266.09 g/mol |
| IUPAC name | 2-amino-5-bromo-4-phenyl-1H-pyrimidin-6-one |
| InChIKey | CIUUIPMOFZIWIZ-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 135413497

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=N2)N)Br |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 135413497
Structure and machine-readable chemical identifiers.
