Identität
(2H8)Naphthalene
Nicht angegeben · C10H8
01Identität
| Lazychem ID | LC-118347 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 92148 |
| Molecular formula | C10H8 |
| Molecular weight | 136.22 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8-octadeuterionaphthalene |
| InChIKey | UFWIBTONFRDIAS-PGRXLJNUSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 92148

The parsed structure contains 2 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 92148
Structure and machine-readable chemical identifiers.
