Identität
Diethyl nitromalonate
Nicht angegeben · C7H11NO6
01Identität
| Lazychem ID | LC-117310 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 97657 |
| Molecular formula | C7H11NO6 |
| Molecular weight | 205.17 g/mol |
| IUPAC name | diethyl 2-nitropropanedioate |
| InChIKey | DAKKWKYIQGMKOS-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 97657

The parsed structure is acyclic, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CCOC(=O)C(C(=O)OCC)[N+](=O)[O-] |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 97657
Structure and machine-readable chemical identifiers.
