Identität
Perfluorobutyl bromide
Nicht angegeben · C4BrF9
01Identität
| Lazychem ID | LC-106152 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 550393 |
| Molecular formula | C4BrF9 |
| Molecular weight | 298.93 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| InChIKey | CVEIKEYTQKDDQK-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 550393

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C(C(C(F)(F)Br)(F)F)(C(F)(F)F)(F)F |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 550393
Structure and machine-readable chemical identifiers.
