Identität
2-Bromo-3-nitropyridine
Nicht angegeben · C5H3BrN2O2
01Identität
| Lazychem ID | LC-106093 |
|---|---|
| CAS RN | Nicht angegeben |
| PubChem CID | 555054 |
| Molecular formula | C5H3BrN2O2 |
| Molecular weight | 202.99 g/mol |
| IUPAC name | 2-bromo-3-nitropyridine |
| InChIKey | ZCCUFLITCDHRMG-UHFFFAOYSA-N |
02Struktur und Stereochemie
2D structurePubChem CID 555054

The parsed structure contains 1 ring, includes aromatic atoms, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(N=C1)Br)[N+](=O)[O-] |
|---|---|
| InChI | Nicht angegeben |
03Status in Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namen und Beziehungen
API und Ausgangsarzneistoff
Nicht angegeben
Namen und Beziehungen
05Quellen
- S01PubChem CID 555054
Structure and machine-readable chemical identifiers.
