Identitet
N-Nitroso Desmethyl Rizatriptan Impurity
Ikke angivet · C14H16N6O
01Identitet
| Lazychem ID | LC-32130 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 169444892 |
| Molecular formula | C14H16N6O |
| Molecular weight | 284.32 g/mol |
| IUPAC name | N-(2-(5-((1H-1,2,4-triazol-1-yl)methyl)-1H-indol-3-yl)ethyl)-N-methylnitrous amide |
| InChIKey | PGNXVLGLQTVKFT-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 169444892

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(CCc2c[nH]c3ccc(Cn1cncn1)cc23)N=O |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Rizatriptan
Urenheder og beslægtede forbindelserNavne og relationer
05Kilder
- S01PubChem CID 169444892
Structure and machine-readable chemical identifiers.
