Identitet
Otilonium-D4 Bromide
Ikke angivet · C29H39D4N2O4. Br
01Identitet
| Lazychem ID | LC-24320 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 163322524 |
| Molecular formula | C29H39D4N2O4. Br |
| Molecular weight | 487.70 79.90 g/mol |
| IUPAC name | N,N-diethyl-N-methyl-2-((4-(2-(octyloxy)benzamido)benzoyl)oxy)ethan-1-aminium-1,1,2,2-d4, bromide (1:1) |
| InChIKey | VWZPIJGXYWHBOW-XHNQVTAOSA-N |
02Struktur og stereokemi
2D structurePubChem CID 163322524

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C(OC([2H])([2H])C([2H])([2H])[N+](CC)(CC)C)C1=CC=C(NC(C2=CC=CC=C2OCCCCCCCC)=O)C=C1.[Br-] |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Otilonium
Urenheder og beslægtede forbindelserNavne og relationer
05Kilder
- S01PubChem CID 163322524
Structure and machine-readable chemical identifiers.
