
Identitet
Alpha-Ionone
Ikke angivet · C13H20O
01Identitet
| Lazychem ID | LC-85550 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 5282108 |
| Molecular formula | C13H20O |
| Molecular weight | 192.30 g/mol |
| IUPAC name | (E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
| InChIKey | UZFLPKAIBPNNCA-BQYQJAHWSA-N |
02Struktur og stereokemi

The parsed structure contains 1 ring, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CCCC(C1/C=C/C(=O)C)(C)C |
|---|---|
| InChI | Ikke angivet |
03Stereochemistry
The published structure contains 0 defined and 1 unassigned tetrahedral stereocentre. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
06Kilder
- S01PubChem CID 5282108
Structure and machine-readable chemical identifiers.
