Identitet
Xct790
Ikke angivet · C23H13F9N4O3S
01Identitet
| Lazychem ID | LC-83571 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 6918788 |
| Molecular formula | C23H13F9N4O3S |
| Molecular weight | 596.4 g/mol |
| IUPAC name | (E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyano-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| InChIKey | HQFNFOOGGLSBBT-AWNIVKPZSA-N |
02Struktur og stereokemi
2D structurePubChem CID 6918788

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=CC(=C1)/C=C(\C#N)/C(=O)NC2=NN=C(S2)C(F)(F)F)OCC3=C(C=C(C=C3)C(F)(F)F)C(F)(F)F |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 6918788
Structure and machine-readable chemical identifiers.
