Identitet
Actb-1003
Ikke angivet · C27H26F5N7O3
01Identitet
| Lazychem ID | LC-64440 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 23653175 |
| Molecular formula | C27H26F5N7O3 |
| Molecular weight | 591.5 g/mol |
| IUPAC name | 1-[4-[4-amino-6-(methoxymethyl)-7-(morpholin-4-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-fluorophenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| InChIKey | GZPJCJKUZPUFAL-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 23653175

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | COCC1=C(N2C(=C1C3=CC(=C(C=C3)NC(=O)NC4=C(C=CC(=C4)C(F)(F)F)F)F)C(=NC=N2)N)CN5CCOCC5 |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 23653175
Structure and machine-readable chemical identifiers.
