Identitet
ML216
Ikke angivet · C15H9F4N5OS
01Identitet
| Lazychem ID | LC-59218 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 49852229 |
| Molecular formula | C15H9F4N5OS |
| Molecular weight | 383.3 g/mol |
| IUPAC name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
| InChIKey | WMCOYUSJXXCHFH-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 49852229

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1NC(=O)NC2=NN=C(S2)C3=CC=NC=C3)C(F)(F)F)F |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 49852229
Structure and machine-readable chemical identifiers.
