Identitet
Picryl Chloride
Ikke angivet · C6H2ClN3O6
01Identitet
| Lazychem ID | LC-54367 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 6953 |
| Molecular formula | C6H2ClN3O6 |
| Molecular weight | 247.55 g/mol |
| IUPAC name | 2-chloro-1,3,5-trinitrobenzene |
| InChIKey | HJRJRUMKQCMYDL-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 6953

The parsed structure contains 1 ring, includes aromatic atoms, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])[N+](=O)[O-] |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 6953
Structure and machine-readable chemical identifiers.
