Identitet
Pcb 114
Ikke angivet · C12H5Cl5
01Identitet
| Lazychem ID | LC-53506 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 53036 |
| Molecular formula | C12H5Cl5 |
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-(4-chlorophenyl)benzene |
| InChIKey | SXZSFWHOSHAKMN-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 53036

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 53036
Structure and machine-readable chemical identifiers.
