Identitet
2,4,6-Trihydroxybenzoic acid
Ikke angivet · C7H6O5
01Identitet
| Lazychem ID | LC-53341 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 66520 |
| Molecular formula | C7H6O5 |
| Molecular weight | 170.12 g/mol |
| IUPAC name | 2,4,6-trihydroxybenzoic acid |
| InChIKey | IBHWREHFNDMRPR-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 66520

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=C(C=C(C(=C1O)C(=O)O)O)O |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 66520
Structure and machine-readable chemical identifiers.
