Identitet
Acitretin Impurity 10
Ikke angivet · C24H32O3
01Identitet
| Lazychem ID | LC-42038 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 23350185 |
| Molecular formula | C24H32O3 |
| Molecular weight | 368.5 g/mol |
| IUPAC name | propan-2-yl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| InChIKey | COXHAKBLKRAXPL-KNSIPEQSSA-N |
02Struktur og stereokemi
2D structurePubChem CID 23350185

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C/C(=C/C(=O)OC(C)C)/C)/C)C)C)OC |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 23350185
Structure and machine-readable chemical identifiers.
