Identitet
Sunitinib Impurity E
Ikke angivet · C18H19FN4O2
01Identitet
| Lazychem ID | LC-38249 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 71433885 |
| Molecular formula | C18H19FN4O2 |
| Molecular weight | 342.4 g/mol |
| IUPAC name | N-(2-aminoethyl)-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| InChIKey | MUXSMSOGTBJZDC-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 71433885

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(NC(=C1C(=O)NCCN)C)C=C2C3=C(C=CC(=C3)F)NC2=O |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 71433885
Structure and machine-readable chemical identifiers.
