Identitet
Olorofim
Ikke angivet · C28H27FN6O2
01Identitet
| Lazychem ID | LC-36711 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 91885568 |
| Molecular formula | C28H27FN6O2 |
| Molecular weight | 498.6 g/mol |
| IUPAC name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| InChIKey | SUFPWYYDCOKDLL-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 91885568

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | CC1=CC(=C(N1C)C(=O)C(=O)NC2=CC=C(C=C2)N3CCN(CC3)C4=NC=C(C=N4)F)C5=CC=CC=C5 |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 91885568
Structure and machine-readable chemical identifiers.
