Identitet
Enzalutamide Impurity K
Ikke angivet · C20H15F4N3O4S
01Identitet
| Lazychem ID | LC-33646 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 155928979 |
| Molecular formula | C20H15F4N3O4S |
| Molecular weight | 469.4 g/mol |
| IUPAC name | 4-[3-[4-carbamoyl-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoic acid |
| InChIKey | WOILFDBBAKATCG-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 155928979

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1(C(=O)N(C(=S)N1C2=CC(=C(C=C2)C(=O)O)F)C3=CC(=C(C=C3)C(=O)N)C(F)(F)F)C |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 155928979
Structure and machine-readable chemical identifiers.
