Identitet
Monobromobimane
Ikke angivet · C10H11BrN2O2
01Identitet
| Lazychem ID | LC-116051 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 114810 |
| Molecular formula | C10H11BrN2O2 |
| Molecular weight | 271.11 g/mol |
| IUPAC name | 7-(bromomethyl)-1,2,6-trimethylpyrazolo[1,2-a]pyrazole-3,5-dione |
| InChIKey | AHEWZZJEDQVLOP-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 114810

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(N2C(=C(C(=O)N2C1=O)C)CBr)C |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 114810
Structure and machine-readable chemical identifiers.
