Identitet
6:2 FTSA
Ikke angivet · C8H5F13O3S
01Identitet
| Lazychem ID | LC-115760 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 119688 |
| Molecular formula | C8H5F13O3S |
| Molecular weight | 428.17 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
| InChIKey | VIONGDJUYAYOPU-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 119688

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 119688
Structure and machine-readable chemical identifiers.
