Identitet
Tris(pentafluorophenyl)borane
Ikke angivet · C18BF15
01Identitet
| Lazychem ID | LC-105454 |
|---|---|
| CAS RN | Ikke angivet |
| PubChem CID | 582056 |
| Molecular formula | C18BF15 |
| Molecular weight | 512.0 g/mol |
| IUPAC name | tris(2,3,4,5,6-pentafluorophenyl)borane |
| InChIKey | OBAJXDYVZBHCGT-UHFFFAOYSA-N |
02Struktur og stereokemi
2D structurePubChem CID 582056

The parsed structure contains 3 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | B(C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
|---|---|
| InChI | Ikke angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Navne og relationer
API og moderlægemiddel
Ikke angivet
Navne og relationer
05Kilder
- S01PubChem CID 582056
Structure and machine-readable chemical identifiers.
