Identita
Tipiracil D6
CAS 2732919-26-3 · C9H5D6ClN4O2
01Identita
| Lazychem ID | LC-29732 |
|---|---|
| CAS RN | 2732919-26-3 |
| PubChem CID | 169447162 |
| Molecular formula | C9H5D6ClN4O2 |
| Molecular weight | 248.7 g/mol |
| IUPAC name | 5-Chloro-6-((2-iminopyrrolidin-1-yl-3,3,4,4,5,5-d6)methyl)pyrimidine-2,4(1H,3H)-dione |
| InChIKey | QQHMKNYGKVVGCZ-NMFSSPJFSA-N |
02Struktura a stereochemie
2D structurePubChem CID 169447162

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | O=C1NC(CN2C([2H])([2H])C([2H])([2H])C([2H])([2H])C2=N)=C(Cl)C(N1)=O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Tipiracil
Nečistoty a související sloučeninyNázvy a vztahy
05Zdroje
- S01PubChem CID 169447162
Structure and machine-readable chemical identifiers.
