Identita
Sumatriptan EP Impurity G (Free Base)
CAS 2074614-56-3 · C14H19N3O2S
01Identita
| Lazychem ID | LC-28655 |
|---|---|
| CAS RN | 2074614-56-3 |
| PubChem CID | 76971488 |
| Molecular formula | C14H19N3O2S |
| Molecular weight | 293.38 g/mol |
| IUPAC name | N-methyl-1-(2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)methanesulfonamide |
| InChIKey | MDLJZBUGPSOPKK-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 76971488

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CNS(CC1=CC(C(CCN(C)C2)=C2N3)=C3C=C1)(=O)=O |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Sumatriptan
Nečistoty a související sloučeninyNázvy a vztahy
05Zdroje
- S01PubChem CID 76971488
Structure and machine-readable chemical identifiers.
