Identita
N-Nitroso Phenylephrine EP Impurity C
Neuvedeno · C9H10N2O3
01Identita
| Lazychem ID | LC-22288 |
|---|---|
| CAS RN | Neuvedeno |
| PubChem CID | 172990215 |
| Molecular formula | C9H10N2O3 |
| Molecular weight | 194.19 g/mol |
| IUPAC name | N-(2-(3-hydroxyphenyl)-2-oxoethyl)-N-methylnitrous amide |
| InChIKey | DWDPQZJJXPQDKA-UHFFFAOYSA-N |
02Struktura a stereochemie
2D structurePubChem CID 172990215

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | O=NN(CC(C1=CC=CC(O)=C1)=O)C |
|---|---|
| InChI | Neuvedeno |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vztahy
API a mateřské léčivo
Phenylephrine
Nečistoty a související sloučeninyNázvy a vztahy
- N-Niroso Phenylephrone
- N-Nitroso Phenylephrine USP Related Compound C
05Zdroje
- S01PubChem CID 172990215
Structure and machine-readable chemical identifiers.
